C18H28N3O3S+ — CID 7216647
cycloheptyl-[2-[4-(cyclopropylsulfamoyl)anilino]-2-oxoethyl]azanium (PubChem CID 7216647) has the molecular formula C18H28N3O3S+ and a molecular weight of 366.51 g/mol. Its IUPAC name is cycloheptyl-[2-[4-(cyclopropylsulfamoyl)anilino]-2-oxoethyl]azanium.
| Compound Name | cycloheptyl-[2-[4-(cyclopropylsulfamoyl)anilino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 7216647 |
| Molecular Formula | C18H28N3O3S+ |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | cycloheptyl-[2-[4-(cyclopropylsulfamoyl)anilino]-2-oxoethyl]azanium |
| SMILES | O=C(C[NH2+]C1CCCCCC1)Nc1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C18H27N3O3S/c22-18(13-19-14-5-3-1-2-4-6-14)20-15-9-11-17(12-10-15)25(23,24)21-16-7-8-16/h9-12,14,16,19,21H,1-8,13H2,(H,20,22)/p+1 |
| InChIKey | ZLXILZWLHQUTEY-UHFFFAOYSA-O |
| XLogP | 1.35 |
| TPSA | 91.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |