C17H26N3O3S+ — CID 6971323
cyclopentyl-[2-oxo-2-(4-pyrrolidin-1-ylsulfonylanilino)ethyl]azanium (PubChem CID 6971323) has the molecular formula C17H26N3O3S+ and a molecular weight of 352.48 g/mol. Its IUPAC name is cyclopentyl-[2-oxo-2-(4-pyrrolidin-1-ylsulfonylanilino)ethyl]azanium.
| Compound Name | cyclopentyl-[2-oxo-2-(4-pyrrolidin-1-ylsulfonylanilino)ethyl]azanium |
|---|---|
| PubChem CID | 6971323 |
| Molecular Formula | C17H26N3O3S+ |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | cyclopentyl-[2-oxo-2-(4-pyrrolidin-1-ylsulfonylanilino)ethyl]azanium |
| SMILES | O=C(C[NH2+]C1CCCC1)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C17H25N3O3S/c21-17(13-18-14-5-1-2-6-14)19-15-7-9-16(10-8-15)24(22,23)20-11-3-4-12-20/h7-10,14,18H,1-6,11-13H2,(H,19,21)/p+1 |
| InChIKey | JEMZRKYHMNXBLX-UHFFFAOYSA-O |
| XLogP | 0.92 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |