C24H30N2O5S2 — CID 55610639
N-(4-cyclopentylsulfonylphenyl)-2-(4-piperidin-1-ylsulfonylphenyl)acetamide (PubChem CID 55610639) has the molecular formula C24H30N2O5S2 and a molecular weight of 490.65 g/mol. Its IUPAC name is N-(4-cyclopentylsulfonylphenyl)-2-(4-piperidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | N-(4-cyclopentylsulfonylphenyl)-2-(4-piperidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 55610639 |
| Molecular Formula | C24H30N2O5S2 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | N-(4-cyclopentylsulfonylphenyl)-2-(4-piperidin-1-ylsulfonylphenyl)acetamide |
| SMILES | O=C(Cc1ccc(S(=O)(=O)N2CCCCC2)cc1)Nc1ccc(S(=O)(=O)C2CCCC2)cc1 |
| InChI | InChI=1S/C24H30N2O5S2/c27-24(25-20-10-14-22(15-11-20)32(28,29)21-6-2-3-7-21)18-19-8-12-23(13-9-19)33(30,31)26-16-4-1-5-17-26/h8-15,21H,1-7,16-18H2,(H,25,27) |
| InChIKey | OQBXACXTCCAJDH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |