C7H13N3O — CID 159925042
(3R,4R)-4-azido-2,3-dimethyloxane (PubChem CID 159925042) has the molecular formula C7H13N3O and a molecular weight of 155.20 g/mol. Its IUPAC name is (3R,4R)-4-azido-2,3-dimethyloxane.
| Compound Name | (3R,4R)-4-azido-2,3-dimethyloxane |
|---|---|
| PubChem CID | 159925042 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | (3R,4R)-4-azido-2,3-dimethyloxane |
| SMILES | CC1OCC[C@@H](N=[N+]=[N-])[C@H]1C |
| InChI | InChI=1S/C7H13N3O/c1-5-6(2)11-4-3-7(5)9-10-8/h5-7H,3-4H2,1-2H3/t5-,6?,7+/m0/s1 |
| InChIKey | JWXVZAIHFDLVBP-REJBHVJUSA-N |
| XLogP | 2.11 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|