C18H33N3O3 — CID 59979643
(3R,4R)-3-[(2S,4S,5R)-3-azido-6-ethyl-4,5-dimethyloxan-2-yl]oxy-2,4,5,6-tetramethyloxane (PubChem CID 59979643) has the molecular formula C18H33N3O3 and a molecular weight of 339.48 g/mol. Its IUPAC name is (3R,4R)-3-[(2S,4S,5R)-3-azido-6-ethyl-4,5-dimethyloxan-2-yl]oxy-2,4,5,6-tetramethyloxane.
| Compound Name | (3R,4R)-3-[(2S,4S,5R)-3-azido-6-ethyl-4,5-dimethyloxan-2-yl]oxy-2,4,5,6-tetramethyloxane |
|---|---|
| PubChem CID | 59979643 |
| Molecular Formula | C18H33N3O3 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.25 |
| IUPAC Name | (3R,4R)-3-[(2S,4S,5R)-3-azido-6-ethyl-4,5-dimethyloxan-2-yl]oxy-2,4,5,6-tetramethyloxane |
| SMILES | CCC1O[C@@H](O[C@H]2C(C)OC(C)C(C)[C@H]2C)C(N=[N+]=[N-])[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C18H33N3O3/c1-8-15-10(3)11(4)16(20-21-19)18(23-15)24-17-12(5)9(2)13(6)22-14(17)7/h9-18H,8H2,1-7H3/t9?,10-,11+,12-,13?,14?,15?,16?,17-,18+/m1/s1 |
| InChIKey | IOWWYVOYNBQBNY-YWKNRBLZSA-N |
| XLogP | 4.54 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|