C19H34ClN9O4 — CID 123600464
(2R,3S,5S)-3-azido-2-[(3S,5S,6S)-5-azido-2-(azidomethyl)-6-methoxy-4-methyloxan-3-yl]oxy-6-ethyl-4,5-dimethyloxane;chloroethane (PubChem CID 123600464) has the molecular formula C19H34ClN9O4 and a molecular weight of 487.99 g/mol. Its IUPAC name is (2R,3S,5S)-3-azido-2-[(3S,5S,6S)-5-azido-2-(azidomethyl)-6-methoxy-4-methyloxan-3-yl]oxy-6-ethyl-4,5-dimethyloxane;chloroethane.
| Compound Name | (2R,3S,5S)-3-azido-2-[(3S,5S,6S)-5-azido-2-(azidomethyl)-6-methoxy-4-methyloxan-3-yl]oxy-6-ethyl-4,5-dimethyloxane;chloroethane |
|---|---|
| PubChem CID | 123600464 |
| Molecular Formula | C19H34ClN9O4 |
| Molecular Weight | 487.99 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | (2R,3S,5S)-3-azido-2-[(3S,5S,6S)-5-azido-2-(azidomethyl)-6-methoxy-4-methyloxan-3-yl]oxy-6-ethyl-4,5-dimethyloxane;chloroethane |
| SMILES | CCC1O[C@H](O[C@@H]2C(CN=[N+]=[N-])O[C@H](OC)[C@@H](N=[N+]=[N-])C2C)[C@@H](N=[N+]=[N-])C(C)[C@@H]1C.CCCl |
| InChI | InChI=1S/C17H29N9O4.C2H5Cl/c1-6-11-8(2)9(3)13(22-25-19)17(28-11)30-15-10(4)14(23-26-20)16(27-5)29-12(15)7-21-24-18;1-2-3/h8-17H,6-7H2,1-5H3;2H2,1H3/t8-,9?,10?,11?,12?,13-,14-,15-,16-,17+;/m0./s1 |
| InChIKey | VZNHHWLYPCYWBZ-WLCPLWCJSA-N |
| XLogP | 5.70 |
| TPSA | 183.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.99 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|