C17H31N3O5 — CID 118944847
(3S,5S,6R)-6-[(3S,5S,6S)-5-azido-2-ethyl-6-methoxy-4-methyloxan-3-yl]oxy-2,4,5-trimethyloxan-3-ol (PubChem CID 118944847) has the molecular formula C17H31N3O5 and a molecular weight of 357.45 g/mol. Its IUPAC name is (3S,5S,6R)-6-[(3S,5S,6S)-5-azido-2-ethyl-6-methoxy-4-methyloxan-3-yl]oxy-2,4,5-trimethyloxan-3-ol.
| Compound Name | (3S,5S,6R)-6-[(3S,5S,6S)-5-azido-2-ethyl-6-methoxy-4-methyloxan-3-yl]oxy-2,4,5-trimethyloxan-3-ol |
|---|---|
| PubChem CID | 118944847 |
| Molecular Formula | C17H31N3O5 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | (3S,5S,6R)-6-[(3S,5S,6S)-5-azido-2-ethyl-6-methoxy-4-methyloxan-3-yl]oxy-2,4,5-trimethyloxan-3-ol |
| SMILES | CCC1O[C@H](OC)[C@@H](N=[N+]=[N-])C(C)[C@@H]1O[C@H]1OC(C)[C@@H](O)C(C)[C@@H]1C |
| InChI | InChI=1S/C17H31N3O5/c1-7-12-15(10(4)13(19-20-18)17(22-6)24-12)25-16-9(3)8(2)14(21)11(5)23-16/h8-17,21H,7H2,1-6H3/t8?,9-,10?,11?,12?,13-,14-,15-,16+,17-/m0/s1 |
| InChIKey | NZDVRWFWGIQKNA-KOXBTQOVSA-N |
| XLogP | 2.85 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|