C30H34O3Si — CID 11605228
(2R,3S)-1-[tert-butyl(diphenyl)silyl]oxy-3-[2-(4-methoxyphenyl)ethynyl]pent-4-en-2-ol (PubChem CID 11605228) has the molecular formula C30H34O3Si and a molecular weight of 470.69 g/mol. Its IUPAC name is (2R,3S)-1-[tert-butyl(diphenyl)silyl]oxy-3-[2-(4-methoxyphenyl)ethynyl]pent-4-en-2-ol.
| Compound Name | (2R,3S)-1-[tert-butyl(diphenyl)silyl]oxy-3-[2-(4-methoxyphenyl)ethynyl]pent-4-en-2-ol |
|---|---|
| PubChem CID | 11605228 |
| Molecular Formula | C30H34O3Si |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | (2R,3S)-1-[tert-butyl(diphenyl)silyl]oxy-3-[2-(4-methoxyphenyl)ethynyl]pent-4-en-2-ol |
| SMILES | C=C[C@@H](C#Cc1ccc(OC)cc1)[C@@H](O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H34O3Si/c1-6-25(20-17-24-18-21-26(32-5)22-19-24)29(31)23-33-34(30(2,3)4,27-13-9-7-10-14-27)28-15-11-8-12-16-28/h6-16,18-19,21-22,25,29,31H,1,23H2,2-5H3/t25-,29-/m0/s1 |
| InChIKey | AIIDMVFQEAZRHU-SVEHJYQDSA-N |
| XLogP | 4.79 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|