C37H48O4Si — CID 102174057
tert-butyl-[(E,3S)-1-[(2R,5R)-5-[(4-methoxyphenyl)methoxymethyl]-3-methylideneoxolan-2-yl]hept-5-en-3-yl]oxy-diphenylsilane (PubChem CID 102174057) has the molecular formula C37H48O4Si and a molecular weight of 584.87 g/mol. Its IUPAC name is tert-butyl-[(E,3S)-1-[(2R,5R)-5-[(4-methoxyphenyl)methoxymethyl]-3-methylideneoxolan-2-yl]hept-5-en-3-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(E,3S)-1-[(2R,5R)-5-[(4-methoxyphenyl)methoxymethyl]-3-methylideneoxolan-2-yl]hept-5-en-3-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 102174057 |
| Molecular Formula | C37H48O4Si |
| Molecular Weight | 584.87 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | tert-butyl-[(E,3S)-1-[(2R,5R)-5-[(4-methoxyphenyl)methoxymethyl]-3-methylideneoxolan-2-yl]hept-5-en-3-yl]oxy-diphenylsilane |
| SMILES | C=C1C[C@H](COCc2ccc(OC)cc2)O[C@@H]1CC[C@@H](C/C=C/C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C37H48O4Si/c1-7-8-15-32(41-42(37(3,4)5,34-16-11-9-12-17-34)35-18-13-10-14-19-35)24-25-36-29(2)26-33(40-36)28-39-27-30-20-22-31(38-6)23-21-30/h7-14,16-23,32-33,36H,2,15,24-28H2,1,3-6H3/b8-7+/t32-,33-,36-/m1/s1 |
| InChIKey | GGNNDNZRZODZJR-WNVLTCKWSA-N |
| XLogP | 7.62 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.87 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|