C46H62O5Si2 — CID 10887162
(3S)-10-[tert-butyl(dimethyl)silyl]oxy-8-[tert-butyl(diphenyl)silyl]oxy-13-[(4-methoxyphenyl)methoxy]-3-prop-1-en-2-yltrideca-6,11-diynal (PubChem CID 10887162) has the molecular formula C46H62O5Si2 and a molecular weight of 751.17 g/mol. Its IUPAC name is (3S)-10-[tert-butyl(dimethyl)silyl]oxy-8-[tert-butyl(diphenyl)silyl]oxy-13-[(4-methoxyphenyl)methoxy]-3-prop-1-en-2-yltrideca-6,11-diynal.
| Compound Name | (3S)-10-[tert-butyl(dimethyl)silyl]oxy-8-[tert-butyl(diphenyl)silyl]oxy-13-[(4-methoxyphenyl)methoxy]-3-prop-1-en-2-yltrideca-6,11-diynal |
|---|---|
| PubChem CID | 10887162 |
| Molecular Formula | C46H62O5Si2 |
| Molecular Weight | 751.17 g/mol |
| Exact Mass | 750.41 |
| IUPAC Name | (3S)-10-[tert-butyl(dimethyl)silyl]oxy-8-[tert-butyl(diphenyl)silyl]oxy-13-[(4-methoxyphenyl)methoxy]-3-prop-1-en-2-yltrideca-6,11-diynal |
| SMILES | C=C(C)[C@H](CC=O)CCC#CC(CC(C#CCOCc1ccc(OC)cc1)O[Si](C)(C)C(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C46H62O5Si2/c1-37(2)39(32-33-47)21-18-19-22-42(51-53(46(6,7)8,43-24-14-12-15-25-43)44-26-16-13-17-27-44)35-41(50-52(10,11)45(3,4)5)23-20-34-49-36-38-28-30-40(48-9)31-29-38/h12-17,24-31,33,39,41-42H,1,18,21,32,34-36H2,2-11H3/t39-,41?,42?/m0/s1 |
| InChIKey | OQLRBWSSFMQCIG-OAQQNENDSA-N |
| XLogP | 9.51 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.17 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|