C35H56O6Si — CID 135731794
(3R)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-10-(methoxymethoxy)-14-[(4-methoxyphenyl)methoxy]-2,10-dimethylpentadec-1-en-6,12-diyn-8-ol (PubChem CID 135731794) has the molecular formula C35H56O6Si and a molecular weight of 600.91 g/mol. Its IUPAC name is (3R)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-10-(methoxymethoxy)-14-[(4-methoxyphenyl)methoxy]-2,10-dimethylpentadec-1-en-6,12-diyn-8-ol.
| Compound Name | (3R)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-10-(methoxymethoxy)-14-[(4-methoxyphenyl)methoxy]-2,10-dimethylpentadec-1-en-6,12-diyn-8-ol |
|---|---|
| PubChem CID | 135731794 |
| Molecular Formula | C35H56O6Si |
| Molecular Weight | 600.91 g/mol |
| Exact Mass | 600.38 |
| IUPAC Name | (3R)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-10-(methoxymethoxy)-14-[(4-methoxyphenyl)methoxy]-2,10-dimethylpentadec-1-en-6,12-diyn-8-ol |
| SMILES | C=C(C)[C@H](CCC#CC(O)CC(C)(CC#CC(C)OCc1ccc(OC)cc1)OCOC)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H56O6Si/c1-28(2)31(22-24-41-42(10,11)34(4,5)6)16-12-13-17-32(36)25-35(7,40-27-37-8)23-14-15-29(3)39-26-30-18-20-33(38-9)21-19-30/h18-21,29,31-32,36H,1,12,16,22-27H2,2-11H3/t29?,31-,32?,35?/m1/s1 |
| InChIKey | SEGRESWHYOXVAR-XWXLHIJISA-N |
| XLogP | 7.51 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.91 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|