C27H46O6Si — CID 10553266
(2R,4S,8S)-2-[tert-butyl(dimethyl)silyl]oxy-8-(methoxymethoxy)-8-methyl-10-(phenylmethoxymethoxy)dec-5-yn-4-ol (PubChem CID 10553266) has the molecular formula C27H46O6Si and a molecular weight of 494.75 g/mol. Its IUPAC name is (2R,4S,8S)-2-[tert-butyl(dimethyl)silyl]oxy-8-(methoxymethoxy)-8-methyl-10-(phenylmethoxymethoxy)dec-5-yn-4-ol.
| Compound Name | (2R,4S,8S)-2-[tert-butyl(dimethyl)silyl]oxy-8-(methoxymethoxy)-8-methyl-10-(phenylmethoxymethoxy)dec-5-yn-4-ol |
|---|---|
| PubChem CID | 10553266 |
| Molecular Formula | C27H46O6Si |
| Molecular Weight | 494.75 g/mol |
| Exact Mass | 494.31 |
| IUPAC Name | (2R,4S,8S)-2-[tert-butyl(dimethyl)silyl]oxy-8-(methoxymethoxy)-8-methyl-10-(phenylmethoxymethoxy)dec-5-yn-4-ol |
| SMILES | COCO[C@@](C)(CC#C[C@@H](O)C[C@@H](C)O[Si](C)(C)C(C)(C)C)CCOCOCc1ccccc1 |
| InChI | InChI=1S/C27H46O6Si/c1-23(33-34(7,8)26(2,3)4)19-25(28)15-12-16-27(5,32-21-29-6)17-18-30-22-31-20-24-13-10-9-11-14-24/h9-11,13-14,23,25,28H,16-22H2,1-8H3/t23-,25-,27+/m1/s1 |
| InChIKey | XOTZDJKUWOAYTC-HYZYYIOASA-N |
| XLogP | 5.50 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.75 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|