C26H38O5Si — CID 101161578
methyl (2E,4S,6Z)-4-[tert-butyl(dimethyl)silyl]oxy-9-hydroxy-12-phenylmethoxydodeca-2,6-dien-10-ynoate (PubChem CID 101161578) has the molecular formula C26H38O5Si and a molecular weight of 458.67 g/mol. Its IUPAC name is methyl (2E,4S,6Z)-4-[tert-butyl(dimethyl)silyl]oxy-9-hydroxy-12-phenylmethoxydodeca-2,6-dien-10-ynoate.
| Compound Name | methyl (2E,4S,6Z)-4-[tert-butyl(dimethyl)silyl]oxy-9-hydroxy-12-phenylmethoxydodeca-2,6-dien-10-ynoate |
|---|---|
| PubChem CID | 101161578 |
| Molecular Formula | C26H38O5Si |
| Molecular Weight | 458.67 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | methyl (2E,4S,6Z)-4-[tert-butyl(dimethyl)silyl]oxy-9-hydroxy-12-phenylmethoxydodeca-2,6-dien-10-ynoate |
| SMILES | COC(=O)/C=C/[C@H](C/C=C\CC(O)C#CCOCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H38O5Si/c1-26(2,3)32(5,6)31-24(18-19-25(28)29-4)17-11-10-15-23(27)16-12-20-30-21-22-13-8-7-9-14-22/h7-11,13-14,18-19,23-24,27H,15,17,20-21H2,1-6H3/b11-10-,19-18+/t23?,24-/m0/s1 |
| InChIKey | ZTYARSZVHSNDFU-KSNPOVSISA-N |
| XLogP | 5.02 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.67 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|