C23H42O3Si — CID 68648592
tert-butyl-[2,6-dimethyl-7-(phenylmethoxymethoxy)heptan-2-yl]oxy-dimethylsilane (PubChem CID 68648592) has the molecular formula C23H42O3Si and a molecular weight of 394.67 g/mol. Its IUPAC name is tert-butyl-[2,6-dimethyl-7-(phenylmethoxymethoxy)heptan-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[2,6-dimethyl-7-(phenylmethoxymethoxy)heptan-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 68648592 |
| Molecular Formula | C23H42O3Si |
| Molecular Weight | 394.67 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | tert-butyl-[2,6-dimethyl-7-(phenylmethoxymethoxy)heptan-2-yl]oxy-dimethylsilane |
| SMILES | CC(CCCC(C)(C)O[Si](C)(C)C(C)(C)C)COCOCc1ccccc1 |
| InChI | InChI=1S/C23H42O3Si/c1-20(17-24-19-25-18-21-14-10-9-11-15-21)13-12-16-23(5,6)26-27(7,8)22(2,3)4/h9-11,14-15,20H,12-13,16-19H2,1-8H3 |
| InChIKey | ZAEAUFQKSSYDCJ-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.67 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|