C19H33FO2Si — CID 10831054
tert-butyl-(3-fluoro-2,3-dimethyl-4-phenylmethoxybutan-2-yl)oxy-dimethylsilane (PubChem CID 10831054) has the molecular formula C19H33FO2Si and a molecular weight of 340.56 g/mol. Its IUPAC name is tert-butyl-(3-fluoro-2,3-dimethyl-4-phenylmethoxybutan-2-yl)oxy-dimethylsilane.
| Compound Name | tert-butyl-(3-fluoro-2,3-dimethyl-4-phenylmethoxybutan-2-yl)oxy-dimethylsilane |
|---|---|
| PubChem CID | 10831054 |
| Molecular Formula | C19H33FO2Si |
| Molecular Weight | 340.56 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | tert-butyl-(3-fluoro-2,3-dimethyl-4-phenylmethoxybutan-2-yl)oxy-dimethylsilane |
| SMILES | CC(F)(COCc1ccccc1)C(C)(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H33FO2Si/c1-17(2,3)23(7,8)22-18(4,5)19(6,20)15-21-14-16-12-10-9-11-13-16/h9-13H,14-15H2,1-8H3 |
| InChIKey | AAOHEXUTXNRHPC-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.56 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|