C37H54O4Si2 — CID 102195848
(4S)-4-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3-dimethyl-5-phenylmethoxypent-1-en-3-ol (PubChem CID 102195848) has the molecular formula C37H54O4Si2 and a molecular weight of 619.01 g/mol. Its IUPAC name is (4S)-4-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3-dimethyl-5-phenylmethoxypent-1-en-3-ol.
| Compound Name | (4S)-4-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3-dimethyl-5-phenylmethoxypent-1-en-3-ol |
|---|---|
| PubChem CID | 102195848 |
| Molecular Formula | C37H54O4Si2 |
| Molecular Weight | 619.01 g/mol |
| Exact Mass | 618.36 |
| IUPAC Name | (4S)-4-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3-dimethyl-5-phenylmethoxypent-1-en-3-ol |
| SMILES | C=C(C)C(C)(O)[C@](COCc1ccccc1)(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C37H54O4Si2/c1-30(2)36(9,38)37(41-42(10,11)34(3,4)5,28-39-27-31-21-15-12-16-22-31)29-40-43(35(6,7)8,32-23-17-13-18-24-32)33-25-19-14-20-26-33/h12-26,38H,1,27-29H2,2-11H3/t36?,37-/m0/s1 |
| InChIKey | SMCQNTDMWXNOMM-RWXFGYRSSA-N |
| XLogP | 7.87 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.01 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|