C31H50O5Si2 — CID 102195851
(4S)-4-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(methoxymethoxy)-3-methylpent-1-en-3-ol (PubChem CID 102195851) has the molecular formula C31H50O5Si2 and a molecular weight of 558.91 g/mol. Its IUPAC name is (4S)-4-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(methoxymethoxy)-3-methylpent-1-en-3-ol.
| Compound Name | (4S)-4-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(methoxymethoxy)-3-methylpent-1-en-3-ol |
|---|---|
| PubChem CID | 102195851 |
| Molecular Formula | C31H50O5Si2 |
| Molecular Weight | 558.91 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | (4S)-4-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(methoxymethoxy)-3-methylpent-1-en-3-ol |
| SMILES | C=CC(C)(O)[C@](COCOC)(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H50O5Si2/c1-12-30(8,32)31(23-34-25-33-9,36-37(10,11)28(2,3)4)24-35-38(29(5,6)7,26-19-15-13-16-20-26)27-21-17-14-18-22-27/h12-22,32H,1,23-25H2,2-11H3/t30?,31-/m0/s1 |
| InChIKey | JNVCPICVGSVTKF-FLDQDSGZSA-N |
| XLogP | 5.88 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.91 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|