C17H30O3Si — CID 101190578
(2R)-4-[tert-butyl-methyl-(phenylmethoxymethyl)silyl]oxybutan-2-ol (PubChem CID 101190578) has the molecular formula C17H30O3Si and a molecular weight of 310.51 g/mol. Its IUPAC name is (2R)-4-[tert-butyl-methyl-(phenylmethoxymethyl)silyl]oxybutan-2-ol.
| Compound Name | (2R)-4-[tert-butyl-methyl-(phenylmethoxymethyl)silyl]oxybutan-2-ol |
|---|---|
| PubChem CID | 101190578 |
| Molecular Formula | C17H30O3Si |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | (2R)-4-[tert-butyl-methyl-(phenylmethoxymethyl)silyl]oxybutan-2-ol |
| SMILES | C[C@@H](O)CCO[Si@](C)(COCc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C17H30O3Si/c1-15(18)11-12-20-21(5,17(2,3)4)14-19-13-16-9-7-6-8-10-16/h6-10,15,18H,11-14H2,1-5H3/t15-,21-/m1/s1 |
| InChIKey | UJZWHLIGAXDJME-QVKFZJNVSA-N |
| XLogP | 3.91 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|