C21H36O6Si — CID 15449425
methyl (2S,3R,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxy-4-methyl-6-phenylmethoxyhexanoate (PubChem CID 15449425) has the molecular formula C21H36O6Si and a molecular weight of 412.60 g/mol. Its IUPAC name is methyl (2S,3R,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxy-4-methyl-6-phenylmethoxyhexanoate.
| Compound Name | methyl (2S,3R,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxy-4-methyl-6-phenylmethoxyhexanoate |
|---|---|
| PubChem CID | 15449425 |
| Molecular Formula | C21H36O6Si |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | methyl (2S,3R,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxy-4-methyl-6-phenylmethoxyhexanoate |
| SMILES | COC(=O)[C@@H](O)[C@H](O)[C@@H](C)[C@H](COCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H36O6Si/c1-15(18(22)19(23)20(24)25-5)17(27-28(6,7)21(2,3)4)14-26-13-16-11-9-8-10-12-16/h8-12,15,17-19,22-23H,13-14H2,1-7H3/t15-,17-,18+,19-/m0/s1 |
| InChIKey | YTBLCJFMEYPDPH-KANFNMMFSA-N |
| XLogP | 3.12 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|