C30H52O9SSi — CID 10675321
[(13S)-13-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-8-methoxycarbonyloxy-6-(methoxymethoxy)-6,14-dimethylpentadec-14-en-3,9-diyn-2-yl] methanesulfonate (PubChem CID 10675321) has the molecular formula C30H52O9SSi and a molecular weight of 616.89 g/mol. Its IUPAC name is [(13S)-13-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-8-methoxycarbonyloxy-6-(methoxymethoxy)-6,14-dimethylpentadec-14-en-3,9-diyn-2-yl] methanesulfonate.
| Compound Name | [(13S)-13-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-8-methoxycarbonyloxy-6-(methoxymethoxy)-6,14-dimethylpentadec-14-en-3,9-diyn-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 10675321 |
| Molecular Formula | C30H52O9SSi |
| Molecular Weight | 616.89 g/mol |
| Exact Mass | 616.31 |
| IUPAC Name | [(13S)-13-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-8-methoxycarbonyloxy-6-(methoxymethoxy)-6,14-dimethylpentadec-14-en-3,9-diyn-2-yl] methanesulfonate |
| SMILES | C=C(C)[C@@H](CCC#CC(CC(C)(CC#CC(C)OS(C)(=O)=O)OCOC)OC(=O)OC)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H52O9SSi/c1-24(2)26(19-21-37-41(11,12)29(4,5)6)17-13-14-18-27(38-28(31)35-9)22-30(7,36-23-34-8)20-15-16-25(3)39-40(10,32)33/h25-27H,1,13,17,19-23H2,2-12H3/t25?,26-,27?,30?/m0/s1 |
| InChIKey | QFZILPDOFWIKPG-ICDXKXKZSA-N |
| XLogP | 6.05 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.89 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|