C33H54O3Si — CID 66552630
tert-butyl-[(3R,4S,7E,11Z)-4-ethynyl-13-[(4-methoxyphenyl)methoxy]-3,4,7,11-tetramethyltrideca-7,11-dienoxy]-dimethylsilane (PubChem CID 66552630) has the molecular formula C33H54O3Si and a molecular weight of 526.88 g/mol. Its IUPAC name is tert-butyl-[(3R,4S,7E,11Z)-4-ethynyl-13-[(4-methoxyphenyl)methoxy]-3,4,7,11-tetramethyltrideca-7,11-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(3R,4S,7E,11Z)-4-ethynyl-13-[(4-methoxyphenyl)methoxy]-3,4,7,11-tetramethyltrideca-7,11-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 66552630 |
| Molecular Formula | C33H54O3Si |
| Molecular Weight | 526.88 g/mol |
| Exact Mass | 526.38 |
| IUPAC Name | tert-butyl-[(3R,4S,7E,11Z)-4-ethynyl-13-[(4-methoxyphenyl)methoxy]-3,4,7,11-tetramethyltrideca-7,11-dienoxy]-dimethylsilane |
| SMILES | C#C[C@@](C)(CC/C(C)=C/CC/C(C)=C\COCc1ccc(OC)cc1)[C@H](C)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H54O3Si/c1-12-33(8,29(4)22-25-36-37(10,11)32(5,6)7)23-20-27(2)14-13-15-28(3)21-24-35-26-30-16-18-31(34-9)19-17-30/h1,14,16-19,21,29H,13,15,20,22-26H2,2-11H3/b27-14+,28-21-/t29-,33+/m1/s1 |
| InChIKey | WCGYTTLYRHLXPB-QUNUPKBJSA-N |
| XLogP | 9.35 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.88 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|