C25H43IO2Si — CID 66552631
(2Z,6E,10S,11R)-13-[tert-butyl(dimethyl)silyl]oxy-10-(2-iodoethynyl)-3,7,10,11-tetramethyltrideca-2,6-dienal (PubChem CID 66552631) has the molecular formula C25H43IO2Si and a molecular weight of 530.61 g/mol. Its IUPAC name is (2Z,6E,10S,11R)-13-[tert-butyl(dimethyl)silyl]oxy-10-(2-iodoethynyl)-3,7,10,11-tetramethyltrideca-2,6-dienal.
| Compound Name | (2Z,6E,10S,11R)-13-[tert-butyl(dimethyl)silyl]oxy-10-(2-iodoethynyl)-3,7,10,11-tetramethyltrideca-2,6-dienal |
|---|---|
| PubChem CID | 66552631 |
| Molecular Formula | C25H43IO2Si |
| Molecular Weight | 530.61 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | (2Z,6E,10S,11R)-13-[tert-butyl(dimethyl)silyl]oxy-10-(2-iodoethynyl)-3,7,10,11-tetramethyltrideca-2,6-dienal |
| SMILES | C/C(=C/C=O)CC/C=C(\C)CC[C@](C)(C#CI)[C@H](C)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H43IO2Si/c1-21(11-10-12-22(2)14-19-27)13-16-25(7,17-18-26)23(3)15-20-28-29(8,9)24(4,5)6/h11,14,19,23H,10,12-13,15-16,20H2,1-9H3/b21-11+,22-14-/t23-,25-/m1/s1 |
| InChIKey | DPXBZMYHPAPZLS-VHXSGJIISA-N |
| XLogP | 8.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.61 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|