C38H62O5 — CID 173348551
13-ethoxy-12-(2-ethoxy-4,8,12-trimethyl-14-oxotetradeca-4,8,12-trien-3-yl)oxy-3,7,11-trimethyltetradeca-2,6,10-trienal (PubChem CID 173348551) has the molecular formula C38H62O5 and a molecular weight of 598.91 g/mol. Its IUPAC name is 13-ethoxy-12-(2-ethoxy-4,8,12-trimethyl-14-oxotetradeca-4,8,12-trien-3-yl)oxy-3,7,11-trimethyltetradeca-2,6,10-trienal.
| Compound Name | 13-ethoxy-12-(2-ethoxy-4,8,12-trimethyl-14-oxotetradeca-4,8,12-trien-3-yl)oxy-3,7,11-trimethyltetradeca-2,6,10-trienal |
|---|---|
| PubChem CID | 173348551 |
| Molecular Formula | C38H62O5 |
| Molecular Weight | 598.91 g/mol |
| Exact Mass | 598.46 |
| IUPAC Name | 13-ethoxy-12-(2-ethoxy-4,8,12-trimethyl-14-oxotetradeca-4,8,12-trien-3-yl)oxy-3,7,11-trimethyltetradeca-2,6,10-trienal |
| SMILES | CCOC(C)C(OC(C(C)=CCCC(C)=CCCC(C)=CC=O)C(C)OCC)C(C)=CCCC(C)=CCCC(C)=CC=O |
| InChI | InChI=1S/C38H62O5/c1-11-41-35(9)37(33(7)23-15-21-29(3)17-13-19-31(5)25-27-39)43-38(36(10)42-12-2)34(8)24-16-22-30(4)18-14-20-32(6)26-28-40/h17-18,23-28,35-38H,11-16,19-22H2,1-10H3 |
| InChIKey | KKDDZJXRQXDZIL-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.91 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|