C17H28O3 — CID 57206388
12-(methoxymethoxy)-3,7,11-trimethyldodeca-2,6,10-trienal (PubChem CID 57206388) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is 12-(methoxymethoxy)-3,7,11-trimethyldodeca-2,6,10-trienal.
| Compound Name | 12-(methoxymethoxy)-3,7,11-trimethyldodeca-2,6,10-trienal |
|---|---|
| PubChem CID | 57206388 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 12-(methoxymethoxy)-3,7,11-trimethyldodeca-2,6,10-trienal |
| SMILES | COCOCC(C)=CCCC(C)=CCCC(C)=CC=O |
| InChI | InChI=1S/C17H28O3/c1-15(7-5-9-16(2)11-12-18)8-6-10-17(3)13-20-14-19-4/h7,10-12H,5-6,8-9,13-14H2,1-4H3 |
| InChIKey | OBMDUZHDOPUPSR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|