C15H22O2 — CID 56612605
3,7,11-trimethyl-10-oxododeca-2,6,11-trienal (PubChem CID 56612605) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 3,7,11-trimethyl-10-oxododeca-2,6,11-trienal.
| Compound Name | 3,7,11-trimethyl-10-oxododeca-2,6,11-trienal |
|---|---|
| PubChem CID | 56612605 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 3,7,11-trimethyl-10-oxododeca-2,6,11-trienal |
| SMILES | C=C(C)C(=O)CCC(C)=CCCC(C)=CC=O |
| InChI | InChI=1S/C15H22O2/c1-12(2)15(17)9-8-13(3)6-5-7-14(4)10-11-16/h6,10-11H,1,5,7-9H2,2-4H3 |
| InChIKey | KZQSYXJLFUPUHO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|