4,8,12-trimethyl-2-methylidenetetradeca-4,8,12-trienoic acid

C18H28O2 — CID 73412483

IUPAC4,8,12-trimethyl-2-methylidenetetradeca-4,8,12-trienoic acid
SMILESC=C(CC(C)=CCCC(C)=CCCC(C)=CC)C(=O)O
InChIInChI=1S/C18H28O2/c1-6-14(2)9-7-10-15(3)11-8-12-16(4)13-17(5)18(19)20/h6,10,12H,5,7-9,11,13H2,1-4H3,(H,19,20)
InChIKeyRWDKDTYDAXWKPR-UHFFFAOYSA-N
MW276.42 g/mol
LogP5.44
Rot. Bonds9

About 4,8,12-trimethyl-2-methylidenetetradeca-4,8,12-trienoic acid

4,8,12-trimethyl-2-methylidenetetradeca-4,8,12-trienoic acid (PubChem CID 73412483) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is 4,8,12-trimethyl-2-methylidenetetradeca-4,8,12-trienoic acid.

Molecular Properties

Compound Name4,8,12-trimethyl-2-methylidenetetradeca-4,8,12-trienoic acid
PubChem CID73412483
Molecular FormulaC18H28O2
Molecular Weight276.42 g/mol
Exact Mass276.21
IUPAC Name4,8,12-trimethyl-2-methylidenetetradeca-4,8,12-trienoic acid
SMILESC=C(CC(C)=CCCC(C)=CCCC(C)=CC)C(=O)O
InChIInChI=1S/C18H28O2/c1-6-14(2)9-7-10-15(3)11-8-12-16(4)13-17(5)18(19)20/h6,10,12H,5,7-9,11,13H2,1-4H3,(H,19,20)
InChIKeyRWDKDTYDAXWKPR-UHFFFAOYSA-N
XLogP5.44
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds9
Heavy Atoms20
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500276.42
LogP ≤ 55.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 4,8,12-trimethyl-2-methylidenetetradeca-4,8,12-trienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,8,12-trimethyl-2-methylidenetetradeca-4,8,12-trienoic acid?
The IUPAC name of 4,8,12-trimethyl-2-methylidenetetradeca-4,8,12-trienoic acid (CID 73412483) is 4,8,12-trimethyl-2-methylidenetetradeca-4,8,12-trienoic acid.
What is the SMILES notation for 4,8,12-trimethyl-2-methylidenetetradeca-4,8,12-trienoic acid?
The canonical SMILES for 4,8,12-trimethyl-2-methylidenetetradeca-4,8,12-trienoic acid is C=C(CC(C)=CCCC(C)=CCCC(C)=CC)C(=O)O.
What is the InChIKey of 4,8,12-trimethyl-2-methylidenetetradeca-4,8,12-trienoic acid?
The InChIKey is RWDKDTYDAXWKPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O2/c1-6-14(2)9-7-10-15(3)11-8-12-16(4)13-17(5)18(19)20/h6,10,12H,5,7-9,11,13H2,1-4H3,(H,19,20).
What are the key properties of 4,8,12-trimethyl-2-methylidenetetradeca-4,8,12-trienoic acid?
4,8,12-trimethyl-2-methylidenetetradeca-4,8,12-trienoic acid has a molecular weight of 276.42 g/mol, XLogP of 5.44, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,8,12-trimethyl-2-methylidenetetradeca-4,8,12-trienoic acid is sourced from PubChem (CID 73412483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).