C15H22O3 — CID 54551052
3,7,11-trimethyl-10-oxododeca-2,6,11-trienoic acid (PubChem CID 54551052) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 3,7,11-trimethyl-10-oxododeca-2,6,11-trienoic acid.
| Compound Name | 3,7,11-trimethyl-10-oxododeca-2,6,11-trienoic acid |
|---|---|
| PubChem CID | 54551052 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 3,7,11-trimethyl-10-oxododeca-2,6,11-trienoic acid |
| SMILES | C=C(C)C(=O)CCC(C)=CCCC(C)=CC(=O)O |
| InChI | InChI=1S/C15H22O3/c1-11(2)14(16)9-8-12(3)6-5-7-13(4)10-15(17)18/h6,10H,1,5,7-9H2,2-4H3,(H,17,18) |
| InChIKey | ZJYFKXWFORTUOC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|