C23H44O4 — CID 173348329
1-ethoxy-1-(1-ethoxyethoxy)ethane;3,7,11-trimethyldodeca-2,6,10-trien-1-ol (PubChem CID 173348329) has the molecular formula C23H44O4 and a molecular weight of 384.60 g/mol. Its IUPAC name is 1-ethoxy-1-(1-ethoxyethoxy)ethane;3,7,11-trimethyldodeca-2,6,10-trien-1-ol.
| Compound Name | 1-ethoxy-1-(1-ethoxyethoxy)ethane;3,7,11-trimethyldodeca-2,6,10-trien-1-ol |
|---|---|
| PubChem CID | 173348329 |
| Molecular Formula | C23H44O4 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.32 |
| IUPAC Name | 1-ethoxy-1-(1-ethoxyethoxy)ethane;3,7,11-trimethyldodeca-2,6,10-trien-1-ol |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCO.CCOC(C)OC(C)OCC |
| InChI | InChI=1S/C15H26O.C8H18O3/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16;1-5-9-7(3)11-8(4)10-6-2/h7,9,11,16H,5-6,8,10,12H2,1-4H3;7-8H,5-6H2,1-4H3 |
| InChIKey | CMAMLMDAAXNIID-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|