C18H31NO3 — CID 10686333
(5E,9E)-2-(1-ethoxyethoxy)-11-hydroxy-4,5,9-trimethylundeca-5,9-dienenitrile (PubChem CID 10686333) has the molecular formula C18H31NO3 and a molecular weight of 309.45 g/mol. Its IUPAC name is (5E,9E)-2-(1-ethoxyethoxy)-11-hydroxy-4,5,9-trimethylundeca-5,9-dienenitrile.
| Compound Name | (5E,9E)-2-(1-ethoxyethoxy)-11-hydroxy-4,5,9-trimethylundeca-5,9-dienenitrile |
|---|---|
| PubChem CID | 10686333 |
| Molecular Formula | C18H31NO3 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | (5E,9E)-2-(1-ethoxyethoxy)-11-hydroxy-4,5,9-trimethylundeca-5,9-dienenitrile |
| SMILES | CCOC(C)OC(C#N)CC(C)/C(C)=C/CC/C(C)=C/CO |
| InChI | InChI=1S/C18H31NO3/c1-6-21-17(5)22-18(13-19)12-16(4)15(3)9-7-8-14(2)10-11-20/h9-10,16-18,20H,6-8,11-12H2,1-5H3/b14-10+,15-9+ |
| InChIKey | HHQUZEAGCZJQTG-WEIBIQTGSA-N |
| XLogP | 3.97 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|