C24H38O6 — CID 11502718
(2R)-2-[(4S,5R,6S)-6-[(2S,4R)-5-[(4-methoxyphenyl)methoxy]-4-methylpentan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propanoic acid (PubChem CID 11502718) has the molecular formula C24H38O6 and a molecular weight of 422.56 g/mol. Its IUPAC name is (2R)-2-[(4S,5R,6S)-6-[(2S,4R)-5-[(4-methoxyphenyl)methoxy]-4-methylpentan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propanoic acid.
| Compound Name | (2R)-2-[(4S,5R,6S)-6-[(2S,4R)-5-[(4-methoxyphenyl)methoxy]-4-methylpentan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propanoic acid |
|---|---|
| PubChem CID | 11502718 |
| Molecular Formula | C24H38O6 |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | (2R)-2-[(4S,5R,6S)-6-[(2S,4R)-5-[(4-methoxyphenyl)methoxy]-4-methylpentan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propanoic acid |
| SMILES | COc1ccc(COC[C@H](C)C[C@H](C)[C@@H]2OC(C)(C)O[C@H]([C@@H](C)C(=O)O)[C@@H]2C)cc1 |
| InChI | InChI=1S/C24H38O6/c1-15(13-28-14-19-8-10-20(27-7)11-9-19)12-16(2)21-17(3)22(18(4)23(25)26)30-24(5,6)29-21/h8-11,15-18,21-22H,12-14H2,1-7H3,(H,25,26)/t15-,16+,17-,18-,21+,22+/m1/s1 |
| InChIKey | RFIWBLLDDQBMMC-KVEFOAQZSA-N |
| XLogP | 4.75 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |