C14H20O2 — CID 101467389
1-(2-ethylbut-3-enoxymethyl)-4-methoxybenzene (PubChem CID 101467389) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is 1-(2-ethylbut-3-enoxymethyl)-4-methoxybenzene.
| Compound Name | 1-(2-ethylbut-3-enoxymethyl)-4-methoxybenzene |
|---|---|
| PubChem CID | 101467389 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 1-(2-ethylbut-3-enoxymethyl)-4-methoxybenzene |
| SMILES | C=CC(CC)COCc1ccc(OC)cc1 |
| InChI | InChI=1S/C14H20O2/c1-4-12(5-2)10-16-11-13-6-8-14(15-3)9-7-13/h4,6-9,12H,1,5,10-11H2,2-3H3 |
| InChIKey | VIVUSCQXDJVRJU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|