C24H30O4 — CID 101016068
(1R,2S,3R,5E)-3-[(4-methoxyphenyl)methoxy]-2-methyl-5-(2-phenylmethoxyethylidene)cyclohexan-1-ol (PubChem CID 101016068) has the molecular formula C24H30O4 and a molecular weight of 382.50 g/mol. Its IUPAC name is (1R,2S,3R,5E)-3-[(4-methoxyphenyl)methoxy]-2-methyl-5-(2-phenylmethoxyethylidene)cyclohexan-1-ol.
| Compound Name | (1R,2S,3R,5E)-3-[(4-methoxyphenyl)methoxy]-2-methyl-5-(2-phenylmethoxyethylidene)cyclohexan-1-ol |
|---|---|
| PubChem CID | 101016068 |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | (1R,2S,3R,5E)-3-[(4-methoxyphenyl)methoxy]-2-methyl-5-(2-phenylmethoxyethylidene)cyclohexan-1-ol |
| SMILES | COc1ccc(CO[C@@H]2C/C(=C/COCc3ccccc3)C[C@@H](O)[C@@H]2C)cc1 |
| InChI | InChI=1S/C24H30O4/c1-18-23(25)14-21(12-13-27-16-19-6-4-3-5-7-19)15-24(18)28-17-20-8-10-22(26-2)11-9-20/h3-12,18,23-25H,13-17H2,1-2H3/b21-12+/t18-,23+,24+/m0/s1 |
| InChIKey | BTWSPAHFTIMBBO-SEEWTNEOSA-N |
| XLogP | 4.51 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|