C32H44O6 — CID 24814944
(2R,3R,6Z,9R)-2-[(E,3S)-4-(methoxymethoxy)-3-methylbut-1-enyl]-3-[(4-methoxyphenyl)methoxy]-7-methyl-9-(phenylmethoxymethyl)-2,3,4,5,8,9-hexahydrooxonine (PubChem CID 24814944) has the molecular formula C32H44O6 and a molecular weight of 524.70 g/mol. Its IUPAC name is (2R,3R,6Z,9R)-2-[(E,3S)-4-(methoxymethoxy)-3-methylbut-1-enyl]-3-[(4-methoxyphenyl)methoxy]-7-methyl-9-(phenylmethoxymethyl)-2,3,4,5,8,9-hexahydrooxonine.
| Compound Name | (2R,3R,6Z,9R)-2-[(E,3S)-4-(methoxymethoxy)-3-methylbut-1-enyl]-3-[(4-methoxyphenyl)methoxy]-7-methyl-9-(phenylmethoxymethyl)-2,3,4,5,8,9-hexahydrooxonine |
|---|---|
| PubChem CID | 24814944 |
| Molecular Formula | C32H44O6 |
| Molecular Weight | 524.70 g/mol |
| Exact Mass | 524.31 |
| IUPAC Name | (2R,3R,6Z,9R)-2-[(E,3S)-4-(methoxymethoxy)-3-methylbut-1-enyl]-3-[(4-methoxyphenyl)methoxy]-7-methyl-9-(phenylmethoxymethyl)-2,3,4,5,8,9-hexahydrooxonine |
| SMILES | COCOC[C@@H](C)/C=C/[C@H]1O[C@@H](COCc2ccccc2)C/C(C)=C\CC[C@H]1OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C32H44O6/c1-25-9-8-12-31(37-22-28-14-16-29(34-4)17-15-28)32(18-13-26(2)20-36-24-33-3)38-30(19-25)23-35-21-27-10-6-5-7-11-27/h5-7,9-11,13-18,26,30-32H,8,12,19-24H2,1-4H3/b18-13+,25-9-/t26-,30+,31+,32+/m0/s1 |
| InChIKey | OSFPZTMXSDFKNV-RPPYZFKPSA-N |
| XLogP | 6.49 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.70 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|