C43H42O9 — CID 70907910
(3R,4S,5S)-6-[bis[(4-methoxyphenyl)methoxy]methylidene]-3,4,5-tris(phenylmethoxy)oxan-2-one (PubChem CID 70907910) has the molecular formula C43H42O9 and a molecular weight of 702.80 g/mol. Its IUPAC name is (3R,4S,5S)-6-[bis[(4-methoxyphenyl)methoxy]methylidene]-3,4,5-tris(phenylmethoxy)oxan-2-one.
| Compound Name | (3R,4S,5S)-6-[bis[(4-methoxyphenyl)methoxy]methylidene]-3,4,5-tris(phenylmethoxy)oxan-2-one |
|---|---|
| PubChem CID | 70907910 |
| Molecular Formula | C43H42O9 |
| Molecular Weight | 702.80 g/mol |
| Exact Mass | 702.28 |
| IUPAC Name | (3R,4S,5S)-6-[bis[(4-methoxyphenyl)methoxy]methylidene]-3,4,5-tris(phenylmethoxy)oxan-2-one |
| SMILES | COc1ccc(COC(OCc2ccc(OC)cc2)=C2OC(=O)C(OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C43H42O9/c1-45-36-22-18-34(19-23-36)29-50-43(51-30-35-20-24-37(46-2)25-21-35)41-39(48-27-32-14-8-4-9-15-32)38(47-26-31-12-6-3-7-13-31)40(42(44)52-41)49-28-33-16-10-5-11-17-33/h3-25,38-40H,26-30H2,1-2H3/t38-,39-,40?/m0/s1 |
| InChIKey | CZISFBLOSKWFLZ-UCHUAQGBSA-N |
| XLogP | 7.92 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.80 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|