C14H19NO6 — CID 102365722
(2S,3R,5S)-2-methoxy-5-[(1R)-2-nitro-1-phenylmethoxyethyl]oxolan-3-ol (PubChem CID 102365722) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is (2S,3R,5S)-2-methoxy-5-[(1R)-2-nitro-1-phenylmethoxyethyl]oxolan-3-ol.
| Compound Name | (2S,3R,5S)-2-methoxy-5-[(1R)-2-nitro-1-phenylmethoxyethyl]oxolan-3-ol |
|---|---|
| PubChem CID | 102365722 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | (2S,3R,5S)-2-methoxy-5-[(1R)-2-nitro-1-phenylmethoxyethyl]oxolan-3-ol |
| SMILES | CO[C@H]1O[C@H]([C@@H](C[N+](=O)[O-])OCc2ccccc2)C[C@H]1O |
| InChI | InChI=1S/C14H19NO6/c1-19-14-11(16)7-12(21-14)13(8-15(17)18)20-9-10-5-3-2-4-6-10/h2-6,11-14,16H,7-9H2,1H3/t11-,12+,13-,14+/m1/s1 |
| InChIKey | KJDVYFCHAVSYLC-RQJABVFESA-N |
| XLogP | 0.97 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|