C17H23NO6S2 — CID 11545829
(2S,3R,4R,5R)-5-[(1S)-1-(1,3-dithian-2-yl)-2-nitroethyl]-4-phenylmethoxyoxolane-2,3-diol (PubChem CID 11545829) has the molecular formula C17H23NO6S2 and a molecular weight of 401.51 g/mol. Its IUPAC name is (2S,3R,4R,5R)-5-[(1S)-1-(1,3-dithian-2-yl)-2-nitroethyl]-4-phenylmethoxyoxolane-2,3-diol.
| Compound Name | (2S,3R,4R,5R)-5-[(1S)-1-(1,3-dithian-2-yl)-2-nitroethyl]-4-phenylmethoxyoxolane-2,3-diol |
|---|---|
| PubChem CID | 11545829 |
| Molecular Formula | C17H23NO6S2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | (2S,3R,4R,5R)-5-[(1S)-1-(1,3-dithian-2-yl)-2-nitroethyl]-4-phenylmethoxyoxolane-2,3-diol |
| SMILES | O=[N+]([O-])C[C@H](C1SCCCS1)[C@H]1O[C@H](O)[C@H](O)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C17H23NO6S2/c19-13-15(23-10-11-5-2-1-3-6-11)14(24-16(13)20)12(9-18(21)22)17-25-7-4-8-26-17/h1-3,5-6,12-17,19-20H,4,7-10H2/t12-,13+,14+,15+,16-/m0/s1 |
| InChIKey | SZBFEQHHTRCWBZ-GCSSGZNBSA-N |
| XLogP | 1.74 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|