C21H21NO9 — CID 11059084
[(2R)-2-[(2R,3R,4R)-3-benzoyloxy-4,5-dihydroxyoxolan-2-yl]-3-nitropropyl] benzoate (PubChem CID 11059084) has the molecular formula C21H21NO9 and a molecular weight of 431.40 g/mol. Its IUPAC name is [(2R)-2-[(2R,3R,4R)-3-benzoyloxy-4,5-dihydroxyoxolan-2-yl]-3-nitropropyl] benzoate.
| Compound Name | [(2R)-2-[(2R,3R,4R)-3-benzoyloxy-4,5-dihydroxyoxolan-2-yl]-3-nitropropyl] benzoate |
|---|---|
| PubChem CID | 11059084 |
| Molecular Formula | C21H21NO9 |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | [(2R)-2-[(2R,3R,4R)-3-benzoyloxy-4,5-dihydroxyoxolan-2-yl]-3-nitropropyl] benzoate |
| SMILES | O=C(OC[C@@H](C[N+](=O)[O-])[C@H]1OC(O)[C@H](O)[C@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H21NO9/c23-16-18(31-20(25)14-9-5-2-6-10-14)17(30-21(16)26)15(11-22(27)28)12-29-19(24)13-7-3-1-4-8-13/h1-10,15-18,21,23,26H,11-12H2/t15-,16-,17-,18-,21?/m1/s1 |
| InChIKey | UHAKJKTURPMLNN-VNTIUTJASA-N |
| XLogP | 1.04 |
| TPSA | 145.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|