C17H23NO6S2 — CID 11704068
(1S,2S,3S,4R,5S,6S)-5-(1,3-dithian-2-yl)-6-nitro-3-phenylmethoxycyclohexane-1,2,4-triol (PubChem CID 11704068) has the molecular formula C17H23NO6S2 and a molecular weight of 401.51 g/mol. Its IUPAC name is (1S,2S,3S,4R,5S,6S)-5-(1,3-dithian-2-yl)-6-nitro-3-phenylmethoxycyclohexane-1,2,4-triol.
| Compound Name | (1S,2S,3S,4R,5S,6S)-5-(1,3-dithian-2-yl)-6-nitro-3-phenylmethoxycyclohexane-1,2,4-triol |
|---|---|
| PubChem CID | 11704068 |
| Molecular Formula | C17H23NO6S2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | (1S,2S,3S,4R,5S,6S)-5-(1,3-dithian-2-yl)-6-nitro-3-phenylmethoxycyclohexane-1,2,4-triol |
| SMILES | O=[N+]([O-])[C@@H]1[C@H](O)[C@H](O)[C@@H](OCc2ccccc2)[C@H](O)[C@H]1C1SCCCS1 |
| InChI | InChI=1S/C17H23NO6S2/c19-13-11(17-25-7-4-8-26-17)12(18(22)23)14(20)15(21)16(13)24-9-10-5-2-1-3-6-10/h1-3,5-6,11-17,19-21H,4,7-9H2/t11-,12-,13+,14-,15-,16-/m0/s1 |
| InChIKey | ZDPGDPKDHQKDGA-IATJYDTKSA-N |
| XLogP | 1.13 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|