C36H46O7 — CID 134872436
2-[(2R,3S,6R)-3-hydroxy-6-[(1R,6S)-1,6,8-tris(phenylmethoxy)octyl]oxan-2-yl]acetic acid (PubChem CID 134872436) has the molecular formula C36H46O7 and a molecular weight of 590.76 g/mol. Its IUPAC name is 2-[(2R,3S,6R)-3-hydroxy-6-[(1R,6S)-1,6,8-tris(phenylmethoxy)octyl]oxan-2-yl]acetic acid.
| Compound Name | 2-[(2R,3S,6R)-3-hydroxy-6-[(1R,6S)-1,6,8-tris(phenylmethoxy)octyl]oxan-2-yl]acetic acid |
|---|---|
| PubChem CID | 134872436 |
| Molecular Formula | C36H46O7 |
| Molecular Weight | 590.76 g/mol |
| Exact Mass | 590.32 |
| IUPAC Name | 2-[(2R,3S,6R)-3-hydroxy-6-[(1R,6S)-1,6,8-tris(phenylmethoxy)octyl]oxan-2-yl]acetic acid |
| SMILES | O=C(O)C[C@H]1O[C@@H]([C@@H](CCCC[C@@H](CCOCc2ccccc2)OCc2ccccc2)OCc2ccccc2)CC[C@@H]1O |
| InChI | InChI=1S/C36H46O7/c37-32-20-21-34(43-35(32)24-36(38)39)33(42-27-30-16-8-3-9-17-30)19-11-10-18-31(41-26-29-14-6-2-7-15-29)22-23-40-25-28-12-4-1-5-13-28/h1-9,12-17,31-35,37H,10-11,18-27H2,(H,38,39)/t31-,32-,33+,34+,35+/m0/s1 |
| InChIKey | MXXITKSBLKLUTF-YQAAHHDASA-N |
| XLogP | 6.71 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.76 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|