C20H28Br2O3 — CID 71484247
(2S,3aS,5R,6aR)-5-[(1S)-1-bromo-4-phenylmethoxybutyl]-2-[(1R)-1-bromopropyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (PubChem CID 71484247) has the molecular formula C20H28Br2O3 and a molecular weight of 476.25 g/mol. Its IUPAC name is (2S,3aS,5R,6aR)-5-[(1S)-1-bromo-4-phenylmethoxybutyl]-2-[(1R)-1-bromopropyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan.
| Compound Name | (2S,3aS,5R,6aR)-5-[(1S)-1-bromo-4-phenylmethoxybutyl]-2-[(1R)-1-bromopropyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 71484247 |
| Molecular Formula | C20H28Br2O3 |
| Molecular Weight | 476.25 g/mol |
| Exact Mass | 474.04 |
| IUPAC Name | (2S,3aS,5R,6aR)-5-[(1S)-1-bromo-4-phenylmethoxybutyl]-2-[(1R)-1-bromopropyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| SMILES | CC[C@@H](Br)[C@@H]1C[C@@H]2O[C@@H]([C@@H](Br)CCCOCc3ccccc3)C[C@H]2O1 |
| InChI | InChI=1S/C20H28Br2O3/c1-2-15(21)17-11-19-20(24-17)12-18(25-19)16(22)9-6-10-23-13-14-7-4-3-5-8-14/h3-5,7-8,15-20H,2,6,9-13H2,1H3/t15-,16+,17+,18-,19+,20-/m1/s1 |
| InChIKey | NQCLFRYKTXRNNS-UPQMVPBKSA-N |
| XLogP | 5.24 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.25 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|