C23H32O5 — CID 11440640
(5R)-5-[(2S,5S)-5-[(E,1R)-1-hydroxy-8-phenylmethoxyoct-4-enyl]oxolan-2-yl]oxolan-2-one (PubChem CID 11440640) has the molecular formula C23H32O5 and a molecular weight of 388.50 g/mol. Its IUPAC name is (5R)-5-[(2S,5S)-5-[(E,1R)-1-hydroxy-8-phenylmethoxyoct-4-enyl]oxolan-2-yl]oxolan-2-one.
| Compound Name | (5R)-5-[(2S,5S)-5-[(E,1R)-1-hydroxy-8-phenylmethoxyoct-4-enyl]oxolan-2-yl]oxolan-2-one |
|---|---|
| PubChem CID | 11440640 |
| Molecular Formula | C23H32O5 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | (5R)-5-[(2S,5S)-5-[(E,1R)-1-hydroxy-8-phenylmethoxyoct-4-enyl]oxolan-2-yl]oxolan-2-one |
| SMILES | O=C1CC[C@H]([C@@H]2CC[C@@H]([C@H](O)CC/C=C/CCCOCc3ccccc3)O2)O1 |
| InChI | InChI=1S/C23H32O5/c24-19(20-12-13-21(27-20)22-14-15-23(25)28-22)11-7-2-1-3-8-16-26-17-18-9-5-4-6-10-18/h1-2,4-6,9-10,19-22,24H,3,7-8,11-17H2/b2-1+/t19-,20+,21+,22-/m1/s1 |
| InChIKey | BDIOUTVMNFEQJR-SLUNCOKISA-N |
| XLogP | 3.93 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|