C18H22O3 — CID 14737833
5-[(E)-1-hydroxy-6-phenylmethoxyhex-2-enyl]cyclopent-2-en-1-one (PubChem CID 14737833) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is 5-[(E)-1-hydroxy-6-phenylmethoxyhex-2-enyl]cyclopent-2-en-1-one.
| Compound Name | 5-[(E)-1-hydroxy-6-phenylmethoxyhex-2-enyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 14737833 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 5-[(E)-1-hydroxy-6-phenylmethoxyhex-2-enyl]cyclopent-2-en-1-one |
| SMILES | O=C1C=CCC1C(O)/C=C/CCCOCc1ccccc1 |
| InChI | InChI=1S/C18H22O3/c19-17(16-10-7-12-18(16)20)11-5-2-6-13-21-14-15-8-3-1-4-9-15/h1,3-5,7-9,11-12,16-17,19H,2,6,10,13-14H2/b11-5+ |
| InChIKey | DEEJRCLVWOXDPM-VZUCSPMQSA-N |
| XLogP | 3.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|