C14H17F3O — CID 162559957
[(E)-7,7,7-trifluorohept-4-enoxy]methylbenzene (PubChem CID 162559957) has the molecular formula C14H17F3O and a molecular weight of 258.28 g/mol. Its IUPAC name is [(E)-7,7,7-trifluorohept-4-enoxy]methylbenzene.
| Compound Name | [(E)-7,7,7-trifluorohept-4-enoxy]methylbenzene |
|---|---|
| PubChem CID | 162559957 |
| Molecular Formula | C14H17F3O |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | [(E)-7,7,7-trifluorohept-4-enoxy]methylbenzene |
| SMILES | FC(F)(F)C/C=C/CCCOCc1ccccc1 |
| InChI | InChI=1S/C14H17F3O/c15-14(16,17)10-6-1-2-7-11-18-12-13-8-4-3-5-9-13/h1,3-6,8-9H,2,7,10-12H2/b6-1+ |
| InChIKey | DKZZIAUNQLBMHN-LZCJLJQNSA-N |
| XLogP | 4.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|