C16H22O2 — CID 10955854
(2E,4E)-2-methyl-8-phenylmethoxyocta-2,4-dien-1-ol (PubChem CID 10955854) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is (2E,4E)-2-methyl-8-phenylmethoxyocta-2,4-dien-1-ol.
| Compound Name | (2E,4E)-2-methyl-8-phenylmethoxyocta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 10955854 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | (2E,4E)-2-methyl-8-phenylmethoxyocta-2,4-dien-1-ol |
| SMILES | C/C(=C\C=C\CCCOCc1ccccc1)CO |
| InChI | InChI=1S/C16H22O2/c1-15(13-17)9-5-2-3-8-12-18-14-16-10-6-4-7-11-16/h2,4-7,9-11,17H,3,8,12-14H2,1H3/b5-2+,15-9+ |
| InChIKey | YBFITVPKQWIGIL-XNWLVXFCSA-N |
| XLogP | 3.48 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|