C19H26O4 — CID 44541660
(E,6S)-6-[(2S,6R)-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran-6-yl]hex-2-ene-1,6-diol (PubChem CID 44541660) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is (E,6S)-6-[(2S,6R)-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran-6-yl]hex-2-ene-1,6-diol.
| Compound Name | (E,6S)-6-[(2S,6R)-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran-6-yl]hex-2-ene-1,6-diol |
|---|---|
| PubChem CID | 44541660 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (E,6S)-6-[(2S,6R)-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran-6-yl]hex-2-ene-1,6-diol |
| SMILES | OC/C=C/CC[C@H](O)[C@H]1C=CC[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C19H26O4/c20-13-6-2-5-11-18(21)19-12-7-10-17(23-19)15-22-14-16-8-3-1-4-9-16/h1-4,6-9,12,17-21H,5,10-11,13-15H2/b6-2+/t17-,18-,19+/m0/s1 |
| InChIKey | FOJKBQQBVRITKY-RLRMVEOCSA-N |
| XLogP | 2.61 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|