C21H30O3 — CID 70454822
(Z)-7-[(1S,2S,3S,4R)-3-(phenylmethoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-en-1-ol (PubChem CID 70454822) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is (Z)-7-[(1S,2S,3S,4R)-3-(phenylmethoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-en-1-ol.
| Compound Name | (Z)-7-[(1S,2S,3S,4R)-3-(phenylmethoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-en-1-ol |
|---|---|
| PubChem CID | 70454822 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | (Z)-7-[(1S,2S,3S,4R)-3-(phenylmethoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-en-1-ol |
| SMILES | OCCCC/C=C\C[C@H]1[C@@H](COCc2ccccc2)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C21H30O3/c22-14-8-3-1-2-7-11-18-19(21-13-12-20(18)24-21)16-23-15-17-9-5-4-6-10-17/h2,4-7,9-10,18-22H,1,3,8,11-16H2/b7-2-/t18-,19+,20-,21+/m0/s1 |
| InChIKey | RCNOYDCMJZJQCO-YALNSNIESA-N |
| XLogP | 4.11 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|