C18H36O3 — CID 162224348
2,6-dimethyloxane;2,4-dimethyloxetane;2,5-dimethyloxolane (PubChem CID 162224348) has the molecular formula C18H36O3 and a molecular weight of 300.48 g/mol. Its IUPAC name is 2,6-dimethyloxane;2,4-dimethyloxetane;2,5-dimethyloxolane.
| Compound Name | 2,6-dimethyloxane;2,4-dimethyloxetane;2,5-dimethyloxolane |
|---|---|
| PubChem CID | 162224348 |
| Molecular Formula | C18H36O3 |
| Molecular Weight | 300.48 g/mol |
| Exact Mass | 300.27 |
| IUPAC Name | 2,6-dimethyloxane;2,4-dimethyloxetane;2,5-dimethyloxolane |
| SMILES | CC1CC(C)O1.CC1CCC(C)O1.CC1CCCC(C)O1 |
| InChI | InChI=1S/C7H14O.C6H12O.C5H10O/c1-6-4-3-5-7(2)8-6;1-5-3-4-6(2)7-5;1-4-3-5(2)6-4/h6-7H,3-5H2,1-2H3;5-6H,3-4H2,1-2H3;4-5H,3H2,1-2H3 |
| InChIKey | ZUNYJNMZMFGCQQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.48 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |