C10H13NO2S — CID 115285077
cyclobutyl 2-amino-2-thiophen-2-ylacetate (PubChem CID 115285077) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is cyclobutyl 2-amino-2-thiophen-2-ylacetate.
| Compound Name | cyclobutyl 2-amino-2-thiophen-2-ylacetate |
|---|---|
| PubChem CID | 115285077 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | cyclobutyl 2-amino-2-thiophen-2-ylacetate |
| SMILES | NC(C(=O)OC1CCC1)c1cccs1 |
| InChI | InChI=1S/C10H13NO2S/c11-9(8-5-2-6-14-8)10(12)13-7-3-1-4-7/h2,5-7,9H,1,3-4,11H2 |
| InChIKey | NAQFCXCCRCPTIC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |