C22H23N3O3S — CID 141352348
N-[4-tert-butyl-5-(2-nitro-1-phenylethyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 141352348) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is N-[4-tert-butyl-5-(2-nitro-1-phenylethyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | N-[4-tert-butyl-5-(2-nitro-1-phenylethyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 141352348 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | N-[4-tert-butyl-5-(2-nitro-1-phenylethyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CC(C)(C)c1nc(NC(=O)c2ccccc2)sc1C(C[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C22H23N3O3S/c1-22(2,3)19-18(17(14-25(27)28)15-10-6-4-7-11-15)29-21(23-19)24-20(26)16-12-8-5-9-13-16/h4-13,17H,14H2,1-3H3,(H,23,24,26) |
| InChIKey | DPUCNJNDPWJWAT-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|