About N-[4-tert-butyl-5-(2-nitro-1-phenylethyl)-1,3-thiazol-2-yl]benzamide
N-[4-tert-butyl-5-(2-nitro-1-phenylethyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 141352348) has the molecular formula C22H23N3O3S
and a molecular weight of 409.51 g/mol. Its IUPAC name is N-[4-tert-butyl-5-(2-nitro-1-phenylethyl)-1,3-thiazol-2-yl]benzamide.
Molecular Properties
| Compound Name | N-[4-tert-butyl-5-(2-nitro-1-phenylethyl)-1,3-thiazol-2-yl]benzamide |
| PubChem CID | 141352348 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | N-[4-tert-butyl-5-(2-nitro-1-phenylethyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CC(C)(C)c1nc(NC(=O)c2ccccc2)sc1C(C[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C22H23N3O3S/c1-22(2,3)19-18(17(14-25(27)28)15-10-6-4-7-11-15)29-21(23-19)24-20(26)16-12-8-5-9-13-16/h4-13,17H,14H2,1-3H3,(H,23,24,26) |
| InChIKey | DPUCNJNDPWJWAT-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[4-tert-butyl-5-(2-nitro-1-phenylethyl)-1,3-thiazol-2-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-tert-butyl-5-(2-nitro-1-phenylethyl)-1,3-thiazol-2-yl]benzamide?
The IUPAC name of N-[4-tert-butyl-5-(2-nitro-1-phenylethyl)-1,3-thiazol-2-yl]benzamide (CID 141352348) is N-[4-tert-butyl-5-(2-nitro-1-phenylethyl)-1,3-thiazol-2-yl]benzamide.
What is the SMILES notation for N-[4-tert-butyl-5-(2-nitro-1-phenylethyl)-1,3-thiazol-2-yl]benzamide?
The canonical SMILES for N-[4-tert-butyl-5-(2-nitro-1-phenylethyl)-1,3-thiazol-2-yl]benzamide is CC(C)(C)c1nc(NC(=O)c2ccccc2)sc1C(C[N+](=O)[O-])c1ccccc1.
What is the InChIKey of N-[4-tert-butyl-5-(2-nitro-1-phenylethyl)-1,3-thiazol-2-yl]benzamide?
The InChIKey is DPUCNJNDPWJWAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N3O3S/c1-22(2,3)19-18(17(14-25(27)28)15-10-6-4-7-11-15)29-21(23-19)24-20(26)16-12-8-5-9-13-16/h4-13,17H,14H2,1-3H3,(H,23,24,26).
What are the key properties of N-[4-tert-butyl-5-(2-nitro-1-phenylethyl)-1,3-thiazol-2-yl]benzamide?
N-[4-tert-butyl-5-(2-nitro-1-phenylethyl)-1,3-thiazol-2-yl]benzamide has a molecular weight of 409.51 g/mol, XLogP of 5.10, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-tert-butyl-5-(2-nitro-1-phenylethyl)-1,3-thiazol-2-yl]benzamide is sourced from PubChem (CID 141352348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).