2-(2-benzamido-4-methyl-1,3-thiazol-5-yl)acetic acid

C13H12N2O3S — CID 82058764

IUPAC2-(2-benzamido-4-methyl-1,3-thiazol-5-yl)acetic acid
SMILESCc1nc(NC(=O)c2ccccc2)sc1CC(=O)O
InChIInChI=1S/C13H12N2O3S/c1-8-10(7-11(16)17)19-13(14-8)15-12(18)9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H,16,17)(H,14,15,18)
InChIKeyZZEOSXOYGLAAGK-UHFFFAOYSA-N
MW276.32 g/mol
LogP2.33
Rot. Bonds4

About 2-(2-benzamido-4-methyl-1,3-thiazol-5-yl)acetic acid

2-(2-benzamido-4-methyl-1,3-thiazol-5-yl)acetic acid (PubChem CID 82058764) has the molecular formula C13H12N2O3S and a molecular weight of 276.32 g/mol. Its IUPAC name is 2-(2-benzamido-4-methyl-1,3-thiazol-5-yl)acetic acid.

Molecular Properties

Compound Name2-(2-benzamido-4-methyl-1,3-thiazol-5-yl)acetic acid
PubChem CID82058764
Molecular FormulaC13H12N2O3S
Molecular Weight276.32 g/mol
Exact Mass276.06
IUPAC Name2-(2-benzamido-4-methyl-1,3-thiazol-5-yl)acetic acid
SMILESCc1nc(NC(=O)c2ccccc2)sc1CC(=O)O
InChIInChI=1S/C13H12N2O3S/c1-8-10(7-11(16)17)19-13(14-8)15-12(18)9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H,16,17)(H,14,15,18)
InChIKeyZZEOSXOYGLAAGK-UHFFFAOYSA-N
XLogP2.33
TPSA79.29 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.32
LogP ≤ 52.33
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(2-benzamido-4-methyl-1,3-thiazol-5-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-benzamido-4-methyl-1,3-thiazol-5-yl)acetic acid?
The IUPAC name of 2-(2-benzamido-4-methyl-1,3-thiazol-5-yl)acetic acid (CID 82058764) is 2-(2-benzamido-4-methyl-1,3-thiazol-5-yl)acetic acid.
What is the SMILES notation for 2-(2-benzamido-4-methyl-1,3-thiazol-5-yl)acetic acid?
The canonical SMILES for 2-(2-benzamido-4-methyl-1,3-thiazol-5-yl)acetic acid is Cc1nc(NC(=O)c2ccccc2)sc1CC(=O)O.
What is the InChIKey of 2-(2-benzamido-4-methyl-1,3-thiazol-5-yl)acetic acid?
The InChIKey is ZZEOSXOYGLAAGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O3S/c1-8-10(7-11(16)17)19-13(14-8)15-12(18)9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H,16,17)(H,14,15,18).
What are the key properties of 2-(2-benzamido-4-methyl-1,3-thiazol-5-yl)acetic acid?
2-(2-benzamido-4-methyl-1,3-thiazol-5-yl)acetic acid has a molecular weight of 276.32 g/mol, XLogP of 2.33, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-benzamido-4-methyl-1,3-thiazol-5-yl)acetic acid is sourced from PubChem (CID 82058764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).